C23H24N6O — CID 53236441
1-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]-3-(4-phenylbutyl)urea (PubChem CID 53236441) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 53236441 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-4-yl]-3-(4-phenylbutyl)urea |
| SMILES | Cn1cc(-c2cnc3c(NC(=O)NCCCCc4ccccc4)ccnc3c2)cn1 |
| InChI | InChI=1S/C23H24N6O/c1-29-16-19(15-27-29)18-13-21-22(26-14-18)20(10-12-24-21)28-23(30)25-11-6-5-9-17-7-3-2-4-8-17/h2-4,7-8,10,12-16H,5-6,9,11H2,1H3,(H2,24,25,28,30) |
| InChIKey | OXOVTEHZHVKLQN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|