C10H11N3 — CID 53237023
8-ethyl-1,7-naphthyridin-6-amine (PubChem CID 53237023) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 8-ethyl-1,7-naphthyridin-6-amine.
| Compound Name | 8-ethyl-1,7-naphthyridin-6-amine |
|---|---|
| PubChem CID | 53237023 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 8-ethyl-1,7-naphthyridin-6-amine |
| SMILES | CCc1nc(N)cc2cccnc12 |
| InChI | InChI=1S/C10H11N3/c1-2-8-10-7(4-3-5-12-10)6-9(11)13-8/h3-6H,2H2,1H3,(H2,11,13) |
| InChIKey | URVCAJSDAOIJKI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |