C13H22N6O3 — CID 53237794
2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-[3-(methylamino)propyl]acetamide (PubChem CID 53237794) has the molecular formula C13H22N6O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-[3-(methylamino)propyl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 53237794 |
| Molecular Formula | C13H22N6O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)-N-[3-(methylamino)propyl]acetamide |
| SMILES | CNCCCNC(=O)CN1C=NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H22N6O3/c1-14-5-4-6-15-9(20)7-19-8-16-11-10(19)12(21)18(3)13(22)17(11)2/h8,10-11,14H,4-7H2,1-3H3,(H,15,20) |
| InChIKey | YQFRKZHNNQUHFW-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|