C12H20N6O3 — CID 53237796
N-(3-aminopropyl)-2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetamide (PubChem CID 53237796) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetamide.
| Compound Name | N-(3-aminopropyl)-2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetamide |
|---|---|
| PubChem CID | 53237796 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-(3-aminopropyl)-2-(1,3-dimethyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetamide |
| SMILES | CN1C(=O)C2C(N=CN2CC(=O)NCCCN)N(C)C1=O |
| InChI | InChI=1S/C12H20N6O3/c1-16-10-9(11(20)17(2)12(16)21)18(7-15-10)6-8(19)14-5-3-4-13/h7,9-10H,3-6,13H2,1-2H3,(H,14,19) |
| InChIKey | SMVNCGFMRHQAID-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|