C13H9NOSe — CID 53238068
2-(4-deuteriophenyl)-1,2-benzoselenazol-3-one (PubChem CID 53238068) has the molecular formula C13H9NOSe and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-(4-deuteriophenyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(4-deuteriophenyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 53238068 |
| Molecular Formula | C13H9NOSe |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-(4-deuteriophenyl)-1,2-benzoselenazol-3-one |
| SMILES | [2H]c1ccc(-n2[se]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C13H9NOSe/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h1-9H/i1D |
| InChIKey | DYEFUKCXAQOFHX-MICDWDOJSA-N |
| XLogP | 2.05 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|