C15H13NO3Se — CID 88621180
2-(3,5-dimethoxyphenyl)-1,2-benzoselenazol-3-one (PubChem CID 88621180) has the molecular formula C15H13NO3Se and a molecular weight of 334.23 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(3,5-dimethoxyphenyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 88621180 |
| Molecular Formula | C15H13NO3Se |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-1,2-benzoselenazol-3-one |
| SMILES | COc1cc(OC)cc(-n2[se]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C15H13NO3Se/c1-18-11-7-10(8-12(9-11)19-2)16-15(17)13-5-3-4-6-14(13)20-16/h3-9H,1-2H3 |
| InChIKey | ZFCMGPXMKHBZQD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|