C14H11NO2Se — CID 88621478
4-methoxy-2-phenyl-1,2-benzoselenazol-3-one (PubChem CID 88621478) has the molecular formula C14H11NO2Se and a molecular weight of 304.21 g/mol. Its IUPAC name is 4-methoxy-2-phenyl-1,2-benzoselenazol-3-one.
| Compound Name | 4-methoxy-2-phenyl-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 88621478 |
| Molecular Formula | C14H11NO2Se |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-methoxy-2-phenyl-1,2-benzoselenazol-3-one |
| SMILES | COc1cccc2[se]n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C14H11NO2Se/c1-17-11-8-5-9-12-13(11)14(16)15(18-12)10-6-3-2-4-7-10/h2-9H,1H3 |
| InChIKey | QKRFBEWXOVUOPC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|