C14H10FNO2Se — CID 166631306
2-(5-fluoro-2-methoxyphenyl)-1,2-benzoselenazol-3-one (PubChem CID 166631306) has the molecular formula C14H10FNO2Se and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-(5-fluoro-2-methoxyphenyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(5-fluoro-2-methoxyphenyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 166631306 |
| Molecular Formula | C14H10FNO2Se |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 2-(5-fluoro-2-methoxyphenyl)-1,2-benzoselenazol-3-one |
| SMILES | COc1ccc(F)cc1-n1[se]c2ccccc2c1=O |
| InChI | InChI=1S/C14H10FNO2Se/c1-18-12-7-6-9(15)8-11(12)16-14(17)10-4-2-3-5-13(10)19-16/h2-8H,1H3 |
| InChIKey | DULMUIKFSYXIGY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|