C23H24F3N3O3S — CID 53241708
[2-[(4-butan-2-yl-[1,3]thiazolo[4,5-c]pyridin-2-yl)carbamoyl]-4-(trifluoromethyl)phenyl] 3-methylbutanoate (PubChem CID 53241708) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is [2-[(4-butan-2-yl-[1,3]thiazolo[4,5-c]pyridin-2-yl)carbamoyl]-4-(trifluoromethyl)phenyl] 3-methylbutanoate.
| Compound Name | [2-[(4-butan-2-yl-[1,3]thiazolo[4,5-c]pyridin-2-yl)carbamoyl]-4-(trifluoromethyl)phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 53241708 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [2-[(4-butan-2-yl-[1,3]thiazolo[4,5-c]pyridin-2-yl)carbamoyl]-4-(trifluoromethyl)phenyl] 3-methylbutanoate |
| SMILES | CCC(C)c1nccc2sc(NC(=O)c3cc(C(F)(F)F)ccc3OC(=O)CC(C)C)nc12 |
| InChI | InChI=1S/C23H24F3N3O3S/c1-5-13(4)19-20-17(8-9-27-19)33-22(28-20)29-21(31)15-11-14(23(24,25)26)6-7-16(15)32-18(30)10-12(2)3/h6-9,11-13H,5,10H2,1-4H3,(H,28,29,31) |
| InChIKey | ROCBOKMRBAKCTD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|