C22H23N3O7S — CID 53243429
N-[(1S,2R)-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-1-(4-nitrophenyl)-3-oxobutyl]-4-methylbenzenesulfonamide (PubChem CID 53243429) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[(1S,2R)-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-1-(4-nitrophenyl)-3-oxobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-1-(4-nitrophenyl)-3-oxobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 53243429 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[(1S,2R)-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-1-(4-nitrophenyl)-3-oxobutyl]-4-methylbenzenesulfonamide |
| SMILES | CC(=O)[C@H](CN1C(=O)CCC1=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N3O7S/c1-14-3-9-18(10-4-14)33(31,32)23-22(16-5-7-17(8-6-16)25(29)30)19(15(2)26)13-24-20(27)11-12-21(24)28/h3-10,19,22-23H,11-13H2,1-2H3/t19-,22+/m0/s1 |
| InChIKey | NMUSNPGCZYBZBX-SIKLNZKXSA-N |
| XLogP | 2.28 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|