C27H31N4O6+ — CID 53245310
(2,5-dioxopyrrolidin-1-yl) 6-(3,5,5-trimethyl-10,12-dioxo-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaen-11-yl)hexanoate (PubChem CID 53245310) has the molecular formula C27H31N4O6+ and a molecular weight of 507.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(3,5,5-trimethyl-10,12-dioxo-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaen-11-yl)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(3,5,5-trimethyl-10,12-dioxo-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaen-11-yl)hexanoate |
|---|---|
| PubChem CID | 53245310 |
| Molecular Formula | C27H31N4O6+ |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(3,5,5-trimethyl-10,12-dioxo-3,11-diaza-5-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1,7,9(17),13,15-pentaen-11-yl)hexanoate |
| SMILES | CN1C[N+](C)(C)Cc2cc3c4c(cccc4c21)C(=O)N(CCCCCC(=O)ON1C(=O)CCC1=O)C3=O |
| InChI | InChI=1S/C27H31N4O6/c1-28-16-31(2,3)15-17-14-20-24-18(25(17)28)8-7-9-19(24)26(35)29(27(20)36)13-6-4-5-10-23(34)37-30-21(32)11-12-22(30)33/h7-9,14H,4-6,10-13,15-16H2,1-3H3/q+1 |
| InChIKey | YHBGTCPNJGTRMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|