C23H29N3O5 — CID 157350641
6-(4,4,6-trimethyl-10,12-dioxo-6,11-diaza-4-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),8,13,15-pentaen-11-yl)hexanoic acid hydroxide (PubChem CID 157350641) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-(4,4,6-trimethyl-10,12-dioxo-6,11-diaza-4-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),8,13,15-pentaen-11-yl)hexanoic acid hydroxide.
| Compound Name | 6-(4,4,6-trimethyl-10,12-dioxo-6,11-diaza-4-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),8,13,15-pentaen-11-yl)hexanoic acid hydroxide |
|---|---|
| PubChem CID | 157350641 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 6-(4,4,6-trimethyl-10,12-dioxo-6,11-diaza-4-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),8,13,15-pentaen-11-yl)hexanoic acid hydroxide |
| SMILES | CN1C[N+](C)(C)Cc2c1cc1c3c(cccc23)C(=O)N(CCCCCC(=O)O)C1=O.[OH-] |
| InChI | InChI=1S/C23H27N3O4.H2O/c1-24-14-26(2,3)13-18-15-8-7-9-16-21(15)17(12-19(18)24)23(30)25(22(16)29)11-6-4-5-10-20(27)28;/h7-9,12H,4-6,10-11,13-14H2,1-3H3;1H2 |
| InChIKey | CNXVWOCZCBMORH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|