C6H8O2 — CID 5324863
(2S)-2-methyl-2,3-dihydropyran-4-one (PubChem CID 5324863) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is (2S)-2-methyl-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 5324863 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | (2S)-2-methyl-2,3-dihydropyran-4-one |
| SMILES | C[C@H]1CC(=O)C=CO1 |
| InChI | InChI=1S/C6H8O2/c1-5-4-6(7)2-3-8-5/h2-3,5H,4H2,1H3/t5-/m0/s1 |
| InChIKey | QQOGPTKWBZTBHM-YFKPBYRVSA-N |
| XLogP | 0.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |