C6H5F3O2 — CID 101060065
(2R)-2-(trifluoromethyl)-2,3-dihydropyran-4-one (PubChem CID 101060065) has the molecular formula C6H5F3O2 and a molecular weight of 166.10 g/mol. Its IUPAC name is (2R)-2-(trifluoromethyl)-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-(trifluoromethyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101060065 |
| Molecular Formula | C6H5F3O2 |
| Molecular Weight | 166.10 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | (2R)-2-(trifluoromethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C6H5F3O2/c7-6(8,9)5-3-4(10)1-2-11-5/h1-2,5H,3H2/t5-/m1/s1 |
| InChIKey | OAIRNCDQEFBOKH-RXMQYKEDSA-N |
| XLogP | 1.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.10 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |