C8H5F7O2 — CID 101060061
(2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2,3-dihydropyran-4-one (PubChem CID 101060061) has the molecular formula C8H5F7O2 and a molecular weight of 266.11 g/mol. Its IUPAC name is (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2,3-dihydropyran-4-one.
| Compound Name | (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101060061 |
| Molecular Formula | C8H5F7O2 |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | (2R)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H5F7O2/c9-6(10,7(11,12)8(13,14)15)5-3-4(16)1-2-17-5/h1-2,5H,3H2/t5-/m1/s1 |
| InChIKey | KACXYXJCOBZCJD-RXMQYKEDSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|