C15H13F13O2 — CID 101060063
(2S)-2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)-2,3-dihydropyran-4-one (PubChem CID 101060063) has the molecular formula C15H13F13O2 and a molecular weight of 472.24 g/mol. Its IUPAC name is (2S)-2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101060063 |
| Molecular Formula | C15H13F13O2 |
| Molecular Weight | 472.24 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | (2S)-2-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H13F13O2/c16-10(17,5-2-1-3-9-7-8(29)4-6-30-9)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h4,6,9H,1-3,5,7H2/t9-/m0/s1 |
| InChIKey | XUNHBSWPMMTLFY-VIFPVBQESA-N |
| XLogP | 6.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.24 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|