C13H9F13O2 — CID 101060060
(2S)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2,3-dihydropyran-4-one (PubChem CID 101060060) has the molecular formula C13H9F13O2 and a molecular weight of 444.19 g/mol. Its IUPAC name is (2S)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101060060 |
| Molecular Formula | C13H9F13O2 |
| Molecular Weight | 444.19 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | (2S)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H9F13O2/c14-8(15,3-1-7-5-6(27)2-4-28-7)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2,4,7H,1,3,5H2/t7-/m0/s1 |
| InChIKey | FHWHZYVXAFPALG-ZETCQYMHSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|