C14H11F13O2 — CID 101060062
(2S)-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-2,3-dihydropyran-4-one (PubChem CID 101060062) has the molecular formula C14H11F13O2 and a molecular weight of 458.21 g/mol. Its IUPAC name is (2S)-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-2,3-dihydropyran-4-one.
| Compound Name | (2S)-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 101060062 |
| Molecular Formula | C14H11F13O2 |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | (2S)-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@@H](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H11F13O2/c15-9(16,4-1-2-8-6-7(28)3-5-29-8)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h3,5,8H,1-2,4,6H2/t8-/m0/s1 |
| InChIKey | SFKNUYILGDJOHL-QMMMGPOBSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|