C11H6F12O2 — CID 102095378
2-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3-dihydropyran-4-one (PubChem CID 102095378) has the molecular formula C11H6F12O2 and a molecular weight of 398.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 102095378 |
| Molecular Formula | C11H6F12O2 |
| Molecular Weight | 398.14 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C11H6F12O2/c12-6(13)8(16,17)10(20,21)11(22,23)9(18,19)7(14,15)5-3-4(24)1-2-25-5/h1-2,5-6H,3H2 |
| InChIKey | CTJRVHLNPZTTNT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.14 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|