C7H6F4O2 — CID 140605224
2-(1,1,2,2-tetrafluoroethyl)-2,3-dihydropyran-4-one (PubChem CID 140605224) has the molecular formula C7H6F4O2 and a molecular weight of 198.11 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrafluoroethyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(1,1,2,2-tetrafluoroethyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 140605224 |
| Molecular Formula | C7H6F4O2 |
| Molecular Weight | 198.11 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 2-(1,1,2,2-tetrafluoroethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C7H6F4O2/c8-6(9)7(10,11)5-3-4(12)1-2-13-5/h1-2,5-6H,3H2 |
| InChIKey | QXKKDQZFIVXETC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|