C6H6F2O2 — CID 10464474
2-(difluoromethyl)-2,3-dihydropyran-4-one (PubChem CID 10464474) has the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(difluoromethyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 10464474 |
| Molecular Formula | C6H6F2O2 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 2-(difluoromethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(C(F)F)C1 |
| InChI | InChI=1S/C6H6F2O2/c7-6(8)5-3-4(9)1-2-10-5/h1-2,5-6H,3H2 |
| InChIKey | CMZUEKGQBQPQOL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |