C30H27N7O — CID 53249003
[4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-[3-(quinazolin-4-ylamino)phenyl]methanone (PubChem CID 53249003) has the molecular formula C30H27N7O and a molecular weight of 501.59 g/mol. Its IUPAC name is [4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-[3-(quinazolin-4-ylamino)phenyl]methanone.
| Compound Name | [4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-[3-(quinazolin-4-ylamino)phenyl]methanone |
|---|---|
| PubChem CID | 53249003 |
| Molecular Formula | C30H27N7O |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | [4-(5-benzylpyrimidin-2-yl)piperazin-1-yl]-[3-(quinazolin-4-ylamino)phenyl]methanone |
| SMILES | O=C(c1cccc(Nc2ncnc3ccccc23)c1)N1CCN(c2ncc(Cc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C30H27N7O/c38-29(24-9-6-10-25(18-24)35-28-26-11-4-5-12-27(26)33-21-34-28)36-13-15-37(16-14-36)30-31-19-23(20-32-30)17-22-7-2-1-3-8-22/h1-12,18-21H,13-17H2,(H,33,34,35) |
| InChIKey | AXLORJMXVSLFAT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |