C34H30ClN3O — CID 66913836
[3-[3-(3-benzyl-8-chloroquinolin-4-yl)anilino]phenyl]-piperidin-1-ylmethanone (PubChem CID 66913836) has the molecular formula C34H30ClN3O and a molecular weight of 532.09 g/mol. Its IUPAC name is [3-[3-(3-benzyl-8-chloroquinolin-4-yl)anilino]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[3-(3-benzyl-8-chloroquinolin-4-yl)anilino]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 66913836 |
| Molecular Formula | C34H30ClN3O |
| Molecular Weight | 532.09 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | [3-[3-(3-benzyl-8-chloroquinolin-4-yl)anilino]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cccc(Nc2cccc(-c3c(Cc4ccccc4)cnc4c(Cl)cccc34)c2)c1)N1CCCCC1 |
| InChI | InChI=1S/C34H30ClN3O/c35-31-17-9-16-30-32(27(23-36-33(30)31)20-24-10-3-1-4-11-24)25-12-7-14-28(21-25)37-29-15-8-13-26(22-29)34(39)38-18-5-2-6-19-38/h1,3-4,7-17,21-23,37H,2,5-6,18-20H2 |
| InChIKey | XXEKBQKKIWQGIR-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.09 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |