C13H21NO4 — CID 53249430
cis-1-O'-tert-butyl 1-O-ethyl (1R,2S)-2-amino-2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 53249430) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is cis-1-O'-tert-butyl 1-O-ethyl (1R,2S)-2-amino-2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | cis-1-O'-tert-butyl 1-O-ethyl (1R,2S)-2-amino-2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 53249430 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | cis-1-O'-tert-butyl 1-O-ethyl (1R,2S)-2-amino-2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=C[C@@]1(N)C[C@@]1(C(=O)OCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4/c1-6-12(14)8-13(12,9(15)17-7-2)10(16)18-11(3,4)5/h6H,1,7-8,14H2,2-5H3/t12-,13-/m1/s1 |
| InChIKey | MSOSARRMGWPUFP-CHWSQXEVSA-N |
| XLogP | 1.16 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|