C14H10ClN5O — CID 53250552
12-chloro-13-(3-hydroxyazetidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile (PubChem CID 53250552) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is 12-chloro-13-(3-hydroxyazetidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile.
| Compound Name | 12-chloro-13-(3-hydroxyazetidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 53250552 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 12-chloro-13-(3-hydroxyazetidin-1-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(Cl)c(N3CC(O)C3)c12 |
| InChI | InChI=1S/C14H10ClN5O/c15-10-3-18-14-12(13(10)20-5-8(21)6-20)9-1-7(2-16)17-4-11(9)19-14/h1,3-4,8,21H,5-6H2,(H,18,19) |
| InChIKey | BSZNJMNLPFTRML-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |