C16H12F3N7O2 — CID 53251289
1-(6-methoxypyridazin-3-yl)-2-(1-methyltriazol-4-yl)-5-(trifluoromethoxy)benzimidazole (PubChem CID 53251289) has the molecular formula C16H12F3N7O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-2-(1-methyltriazol-4-yl)-5-(trifluoromethoxy)benzimidazole.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-2-(1-methyltriazol-4-yl)-5-(trifluoromethoxy)benzimidazole |
|---|---|
| PubChem CID | 53251289 |
| Molecular Formula | C16H12F3N7O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-2-(1-methyltriazol-4-yl)-5-(trifluoromethoxy)benzimidazole |
| SMILES | COc1ccc(-n2c(-c3cn(C)nn3)nc3cc(OC(F)(F)F)ccc32)nn1 |
| InChI | InChI=1S/C16H12F3N7O2/c1-25-8-11(21-24-25)15-20-10-7-9(28-16(17,18)19)3-4-12(10)26(15)13-5-6-14(27-2)23-22-13/h3-8H,1-2H3 |
| InChIKey | CAUXPFXQXXTLHW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |