C17H13F3N6O — CID 70938156
2-[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)benzimidazol-2-yl]pyrrol-1-amine (PubChem CID 70938156) has the molecular formula C17H13F3N6O and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)benzimidazol-2-yl]pyrrol-1-amine.
| Compound Name | 2-[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)benzimidazol-2-yl]pyrrol-1-amine |
|---|---|
| PubChem CID | 70938156 |
| Molecular Formula | C17H13F3N6O |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[1-(6-methoxypyridazin-3-yl)-5-(trifluoromethyl)benzimidazol-2-yl]pyrrol-1-amine |
| SMILES | COc1ccc(-n2c(-c3cccn3N)nc3cc(C(F)(F)F)ccc32)nn1 |
| InChI | InChI=1S/C17H13F3N6O/c1-27-15-7-6-14(23-24-15)26-12-5-4-10(17(18,19)20)9-11(12)22-16(26)13-3-2-8-25(13)21/h2-9H,21H2,1H3 |
| InChIKey | VVQMXAVESMASPT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |