C20H19BrN6O2 — CID 53252627
4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[1-(methoxymethoxy)-1-pyridin-4-ylethyl]pyrimidin-2-amine (PubChem CID 53252627) has the molecular formula C20H19BrN6O2 and a molecular weight of 455.32 g/mol. Its IUPAC name is 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[1-(methoxymethoxy)-1-pyridin-4-ylethyl]pyrimidin-2-amine.
| Compound Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[1-(methoxymethoxy)-1-pyridin-4-ylethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 53252627 |
| Molecular Formula | C20H19BrN6O2 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-[1-(methoxymethoxy)-1-pyridin-4-ylethyl]pyrimidin-2-amine |
| SMILES | COCOC(C)(c1ccncc1)c1cc(-c2c[nH]c3ncc(Br)cc23)nc(N)n1 |
| InChI | InChI=1S/C20H19BrN6O2/c1-20(29-11-28-2,12-3-5-23-6-4-12)17-8-16(26-19(22)27-17)15-10-25-18-14(15)7-13(21)9-24-18/h3-10H,11H2,1-2H3,(H,24,25)(H2,22,26,27) |
| InChIKey | HHHGWYBKIGTPBU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|