About 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine
4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (PubChem CID 156782671) has the molecular formula C12H9BrN4
and a molecular weight of 289.14 g/mol. Its IUPAC name is 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| PubChem CID | 156782671 |
| Molecular Formula | C12H9BrN4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine |
| SMILES | Nc1cc(-c2c[nH]c3ncc(Br)cc23)ccn1 |
| InChI | InChI=1S/C12H9BrN4/c13-8-4-9-10(6-17-12(9)16-5-8)7-1-2-15-11(14)3-7/h1-6H,(H2,14,15)(H,16,17) |
| InChIKey | MFYHSDLERSXUAT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine (CID 156782671) is 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine.
What is the SMILES notation for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The canonical SMILES for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine is Nc1cc(-c2c[nH]c3ncc(Br)cc23)ccn1.
What is the InChIKey of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
The InChIKey is MFYHSDLERSXUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN4/c13-8-4-9-10(6-17-12(9)16-5-8)7-1-2-15-11(14)3-7/h1-6H,(H2,14,15)(H,16,17).
What are the key properties of 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine?
4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine has a molecular weight of 289.14 g/mol, XLogP of 2.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-2-amine is sourced from PubChem (CID 156782671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).