C22H19N3O4S — CID 53255376
N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-2-naphthalen-2-ylacetamide (PubChem CID 53255376) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 53255376 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-2-naphthalen-2-ylacetamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc4ccccc4c3)cc2)no1 |
| InChI | InChI=1S/C22H19N3O4S/c1-15-12-21(24-29-15)25-30(27,28)20-10-8-19(9-11-20)23-22(26)14-16-6-7-17-4-2-3-5-18(17)13-16/h2-13H,14H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | IGZIWEJRUCQXBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |