C20H14O6 — CID 53260372
(17R,18S)-3,11,15,18-tetrahydroxy-17-methyl-8-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,14,16(20)-octaen-13-one (PubChem CID 53260372) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is (17R,18S)-3,11,15,18-tetrahydroxy-17-methyl-8-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,14,16(20)-octaen-13-one.
| Compound Name | (17R,18S)-3,11,15,18-tetrahydroxy-17-methyl-8-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,14,16(20)-octaen-13-one |
|---|---|
| PubChem CID | 53260372 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (17R,18S)-3,11,15,18-tetrahydroxy-17-methyl-8-oxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,14,16(20)-octaen-13-one |
| SMILES | C[C@@H]1c2c(O)cc(=O)c3c(O)cc4oc5cccc(O)c5c(c4c23)[C@H]1O |
| InChI | InChI=1S/C20H14O6/c1-7-14-9(22)5-10(23)15-11(24)6-13-17(18(14)15)19(20(7)25)16-8(21)3-2-4-12(16)26-13/h2-7,20-22,24-25H,1H3/t7-,20+/m1/s1 |
| InChIKey | IVFSUOIKFPXNAJ-GLEHDBDLSA-N |
| XLogP | 3.37 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|