C11H14Cl6N2O2 — CID 53260509
[(E)-5-methyl-4-(2,2,2-trichloroethanimidoyl)oxyhex-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 53260509) has the molecular formula C11H14Cl6N2O2 and a molecular weight of 418.96 g/mol. Its IUPAC name is [(E)-5-methyl-4-(2,2,2-trichloroethanimidoyl)oxyhex-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-5-methyl-4-(2,2,2-trichloroethanimidoyl)oxyhex-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 53260509 |
| Molecular Formula | C11H14Cl6N2O2 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | [(E)-5-methyl-4-(2,2,2-trichloroethanimidoyl)oxyhex-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/C(O/C(=N/[H])C(Cl)(Cl)Cl)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl6N2O2/c1-6(2)7(21-9(19)11(15,16)17)4-3-5-20-8(18)10(12,13)14/h3-4,6-7,18-19H,5H2,1-2H3/b4-3+,18-8+,19-9+ |
| InChIKey | OYOYNLDANQBPEE-JKFVNIMHSA-N |
| XLogP | 5.30 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|