C24H20N2O4 — CID 5326059
(3aR,10aR)-9-acetyl-2-(4-acetylphenyl)-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-1,3-dione (PubChem CID 5326059) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3aR,10aR)-9-acetyl-2-(4-acetylphenyl)-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-1,3-dione.
| Compound Name | (3aR,10aR)-9-acetyl-2-(4-acetylphenyl)-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-1,3-dione |
|---|---|
| PubChem CID | 5326059 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (3aR,10aR)-9-acetyl-2-(4-acetylphenyl)-3a,4,10,10a-tetrahydropyrrolo[3,4-b]carbazole-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3Cc4c(n(C(C)=O)c5ccccc45)C[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-13(27)15-7-9-16(10-8-15)26-23(29)19-11-18-17-5-3-4-6-21(17)25(14(2)28)22(18)12-20(19)24(26)30/h3-10,19-20H,11-12H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | AAXKUJVYQYPIBG-WOJBJXKFSA-N |
| XLogP | 3.41 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|