C10H14O6 — CID 53260760
(1S,4R,5S,6S,7S,10S,11S)-5,7,10-trihydroxy-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one (PubChem CID 53260760) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (1S,4R,5S,6S,7S,10S,11S)-5,7,10-trihydroxy-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one.
| Compound Name | (1S,4R,5S,6S,7S,10S,11S)-5,7,10-trihydroxy-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one |
|---|---|
| PubChem CID | 53260760 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1S,4R,5S,6S,7S,10S,11S)-5,7,10-trihydroxy-6-methyl-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one |
| SMILES | C[C@H]1[C@H](O)[C@@H]2OC(=O)[C@H]3[C@@H]2[C@]1(O)CO[C@@H]3O |
| InChI | InChI=1S/C10H14O6/c1-3-6(11)7-5-4(9(13)16-7)8(12)15-2-10(3,5)14/h3-8,11-12,14H,2H2,1H3/t3-,4-,5-,6-,7+,8-,10-/m0/s1 |
| InChIKey | FFXUKJKVADHZEA-ODEJUTPZSA-N |
| XLogP | -1.77 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |