C24H10BrF8N3O4S — CID 53261335
5-[4-bromo-5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-1,1-dioxo-2-(2,3,4,5,6-pentafluorophenyl)-1,2-benzothiazol-3-one (PubChem CID 53261335) has the molecular formula C24H10BrF8N3O4S and a molecular weight of 668.32 g/mol. Its IUPAC name is 5-[4-bromo-5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-1,1-dioxo-2-(2,3,4,5,6-pentafluorophenyl)-1,2-benzothiazol-3-one.
| Compound Name | 5-[4-bromo-5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-1,1-dioxo-2-(2,3,4,5,6-pentafluorophenyl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 53261335 |
| Molecular Formula | C24H10BrF8N3O4S |
| Molecular Weight | 668.32 g/mol |
| Exact Mass | 666.94 |
| IUPAC Name | 5-[4-bromo-5-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-1,1-dioxo-2-(2,3,4,5,6-pentafluorophenyl)-1,2-benzothiazol-3-one |
| SMILES | COc1ccc(-c2c(Br)c(C(F)(F)F)nn2-c2ccc3c(c2)C(=O)N(c2c(F)c(F)c(F)c(F)c2F)S3(=O)=O)cc1 |
| InChI | InChI=1S/C24H10BrF8N3O4S/c1-40-11-5-2-9(3-6-11)20-14(25)22(24(31,32)33)34-35(20)10-4-7-13-12(8-10)23(37)36(41(13,38)39)21-18(29)16(27)15(26)17(28)19(21)30/h2-8H,1H3 |
| InChIKey | SMNACKFPTRITBD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.32 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|