C12H15FN4 — CID 53264336
N-[2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethyl]-4-fluoroaniline (PubChem CID 53264336) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is N-[2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethyl]-4-fluoroaniline.
| Compound Name | N-[2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 53264336 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | N-[2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethyl]-4-fluoroaniline |
| SMILES | CCc1n[nH]c(CCNc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H15FN4/c1-2-11-15-12(17-16-11)7-8-14-10-5-3-9(13)4-6-10/h3-6,14H,2,7-8H2,1H3,(H,15,16,17) |
| InChIKey | UZDOFDVHSVFMOK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |