C14H17ClN4O2 — CID 53264362
ethyl 2-[3-[2-(4-chloroanilino)ethyl]-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 53264362) has the molecular formula C14H17ClN4O2 and a molecular weight of 308.77 g/mol. Its IUPAC name is ethyl 2-[3-[2-(4-chloroanilino)ethyl]-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | ethyl 2-[3-[2-(4-chloroanilino)ethyl]-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 53264362 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | ethyl 2-[3-[2-(4-chloroanilino)ethyl]-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(CCNc2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-2-21-14(20)9-13-17-12(18-19-13)7-8-16-11-5-3-10(15)4-6-11/h3-6,16H,2,7-9H2,1H3,(H,17,18,19) |
| InChIKey | DYQBMUFMGMCEGN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |