C11H12ClN3OS2 — CID 53264989
4-chloro-N-(5-cyano-3-prop-2-enyl-2-sulfanylidene-1,3-thiazol-4-yl)butanamide (PubChem CID 53264989) has the molecular formula C11H12ClN3OS2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 4-chloro-N-(5-cyano-3-prop-2-enyl-2-sulfanylidene-1,3-thiazol-4-yl)butanamide.
| Compound Name | 4-chloro-N-(5-cyano-3-prop-2-enyl-2-sulfanylidene-1,3-thiazol-4-yl)butanamide |
|---|---|
| PubChem CID | 53264989 |
| Molecular Formula | C11H12ClN3OS2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-chloro-N-(5-cyano-3-prop-2-enyl-2-sulfanylidene-1,3-thiazol-4-yl)butanamide |
| SMILES | C=CCn1c(NC(=O)CCCCl)c(C#N)sc1=S |
| InChI | InChI=1S/C11H12ClN3OS2/c1-2-6-15-10(8(7-13)18-11(15)17)14-9(16)4-3-5-12/h2H,1,3-6H2,(H,14,16) |
| InChIKey | OYCHKKRCINZQTD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|