C22H20N6O3 — CID 53265708
[2-methoxy-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate (PubChem CID 53265708) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [2-methoxy-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 53265708 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-methoxy-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenyl] cyclopropanecarboxylate |
| SMILES | COc1cc(/C=N/Nc2nnc3c(n2)[nH]c2ccc(C)cc23)ccc1OC(=O)C1CC1 |
| InChI | InChI=1S/C22H20N6O3/c1-12-3-7-16-15(9-12)19-20(24-16)25-22(28-26-19)27-23-11-13-4-8-17(18(10-13)30-2)31-21(29)14-5-6-14/h3-4,7-11,14H,5-6H2,1-2H3,(H2,24,25,27,28)/b23-11+ |
| InChIKey | OKUDPUFYJHSLFQ-FOKLQQMPSA-N |
| XLogP | 3.58 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|