C21H21BrN2O — CID 53268116
(E)-N-(2-bromo-4-ethylphenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 53268116) has the molecular formula C21H21BrN2O and a molecular weight of 397.32 g/mol. Its IUPAC name is (E)-N-(2-bromo-4-ethylphenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-4-ethylphenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53268116 |
| Molecular Formula | C21H21BrN2O |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (E)-N-(2-bromo-4-ethylphenyl)-2-cyano-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)/C(C#N)=C/c2ccc(C(C)C)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H21BrN2O/c1-4-15-7-10-20(19(22)12-15)24-21(25)18(13-23)11-16-5-8-17(9-6-16)14(2)3/h5-12,14H,4H2,1-3H3,(H,24,25)/b18-11+ |
| InChIKey | LPRCUJWCKLPYTI-WOJGMQOQSA-N |
| XLogP | 5.68 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|