C11H10N6S — CID 53269660
2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]guanidine (PubChem CID 53269660) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 53269660 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2c[nH]c3ncccc23)cs1 |
| InChI | InChI=1S/C11H10N6S/c12-10(13)17-11-16-8(5-18-11)7-4-15-9-6(7)2-1-3-14-9/h1-5H,(H,14,15)(H4,12,13,16,17) |
| InChIKey | OXKWEMNPEHZZAZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|