C14H16N2O5S — CID 53270897
2-[(4-sulfamoylphenyl)carbamoyl]cyclohexene-1-carboxylic acid (PubChem CID 53270897) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[(4-sulfamoylphenyl)carbamoyl]cyclohexene-1-carboxylic acid.
| Compound Name | 2-[(4-sulfamoylphenyl)carbamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 53270897 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(4-sulfamoylphenyl)carbamoyl]cyclohexene-1-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2=C(C(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C14H16N2O5S/c15-22(20,21)10-7-5-9(6-8-10)16-13(17)11-3-1-2-4-12(11)14(18)19/h5-8H,1-4H2,(H,16,17)(H,18,19)(H2,15,20,21) |
| InChIKey | YLNDTKHJAFFHDN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |