C19H13N3O4 — CID 5327716
3-(1-methylindol-3-yl)-4-(2-nitrophenyl)pyrrole-2,5-dione (PubChem CID 5327716) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-(2-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-(2-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327716 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-(2-nitrophenyl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3ccccc3[N+](=O)[O-])C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C19H13N3O4/c1-21-10-13(11-6-2-4-8-14(11)21)17-16(18(23)20-19(17)24)12-7-3-5-9-15(12)22(25)26/h2-10H,1H3,(H,20,23,24) |
| InChIKey | HJXOAWWNHWZRHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|