C24H19N3O2 — CID 5327735
3-(2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 5327735) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327735 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-(2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCC4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C24H19N3O2/c1-26-13-16(14-7-2-4-9-17(14)26)21-22(24(29)25-23(21)28)20-15-8-3-5-10-18(15)27-12-6-11-19(20)27/h2-5,7-10,13H,6,11-12H2,1H3,(H,25,28,29) |
| InChIKey | QJISCZMEOOQPLS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|