C15H16N4O4 — CID 53277541
4-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53277541) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53277541 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-(2-amino-3-cyano-7,7-dimethyl-5-oxo-6,8-dihydro-4H-chromen-4-yl)-3-methyloxadiazol-3-ium-5-olate |
| SMILES | C[n+]1noc([O-])c1C1C(C#N)=C(N)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C15H16N4O4/c1-15(2)4-8(20)11-9(5-15)22-13(17)7(6-16)10(11)12-14(21)23-18-19(12)3/h10H,4-5,17H2,1-3H3 |
| InChIKey | MKGGETITYPZYKQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|