C12H12N4O4 — CID 53277533
4-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53277533) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53277533 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(5-acetyl-2-amino-3-cyano-6-methyl-4H-pyran-4-yl)-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CC(=O)C1=C(C)OC(N)=C(C#N)C1c1c([O-])on[n+]1C |
| InChI | InChI=1S/C12H12N4O4/c1-5(17)8-6(2)19-11(14)7(4-13)9(8)10-12(18)20-15-16(10)3/h9H,14H2,1-3H3 |
| InChIKey | KFSMBXZSKMYILI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|