C19H27N3O4S — CID 53277986
1-ethylsulfonyl-N-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 53277986) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53277986 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-ethylsulfonyl-N-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)Nc2ccc(C)c(N3CCCC3=O)c2)CC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-3-27(25,26)21-11-8-15(9-12-21)19(24)20-16-7-6-14(2)17(13-16)22-10-4-5-18(22)23/h6-7,13,15H,3-5,8-12H2,1-2H3,(H,20,24) |
| InChIKey | NSFKTXJUZYTCKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |