C17H11ClN6O2 — CID 5327843
N-(3-chlorophenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 5327843) has the molecular formula C17H11ClN6O2 and a molecular weight of 366.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(3-chlorophenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5327843 |
| Molecular Formula | C17H11ClN6O2 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(3-chlorophenyl)-3-(3-nitrophenyl)-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2[nH]nc3ncnc(Nc4cccc(Cl)c4)c23)c1 |
| InChI | InChI=1S/C17H11ClN6O2/c18-11-4-2-5-12(8-11)21-16-14-15(22-23-17(14)20-9-19-16)10-3-1-6-13(7-10)24(25)26/h1-9H,(H2,19,20,21,22,23) |
| InChIKey | BJCWVHPCCLIDDY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|