C9H10N4O2S2 — CID 5328
View drug profile → sulfamethizole4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 5328) has the molecular formula C9H10N4O2S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5328 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 |
| InChI | InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
| InChIKey | VACCAVUAMIDAGB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|