C27H35Cl2N7O — CID 5328147
1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328147) has the molecular formula C27H35Cl2N7O and a molecular weight of 544.53 g/mol. Its IUPAC name is 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328147 |
| Molecular Formula | C27H35Cl2N7O |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(2-methylpiperidin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CC1CCCCN1CCCNc1ncc2cc(-c3c(Cl)cccc3Cl)c(NC(=O)NC(C)(C)C)nc2n1 |
| InChI | InChI=1S/C27H35Cl2N7O/c1-17-9-5-6-13-36(17)14-8-12-30-25-31-16-18-15-19(22-20(28)10-7-11-21(22)29)24(32-23(18)33-25)34-26(37)35-27(2,3)4/h7,10-11,15-17H,5-6,8-9,12-14H2,1-4H3,(H3,30,31,32,33,34,35,37) |
| InChIKey | TWRMMAAINFMTFO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|